C14H13ClN2O3 — CID 43713579
2-chloro-5-[(2,4-dihydroxyphenyl)methylamino]benzamide (PubChem CID 43713579) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is 2-chloro-5-[(2,4-dihydroxyphenyl)methylamino]benzamide.
| Compound Name | 2-chloro-5-[(2,4-dihydroxyphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 43713579 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-chloro-5-[(2,4-dihydroxyphenyl)methylamino]benzamide |
| SMILES | NC(=O)c1cc(NCc2ccc(O)cc2O)ccc1Cl |
| InChI | InChI=1S/C14H13ClN2O3/c15-12-4-2-9(5-11(12)14(16)20)17-7-8-1-3-10(18)6-13(8)19/h1-6,17-19H,7H2,(H2,16,20) |
| InChIKey | HQHCJEBUHYTLHO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|