C16H15Cl2NO3 — CID 23650049
5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid (PubChem CID 23650049) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 23650049 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(NCCCc2ccc(Cl)c(Cl)c2)ccc1O |
| InChI | InChI=1S/C16H15Cl2NO3/c17-13-5-3-10(8-14(13)18)2-1-7-19-11-4-6-15(20)12(9-11)16(21)22/h3-6,8-9,19-20H,1-2,7H2,(H,21,22) |
| InChIKey | ITJHWZWPRLEEKE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|