5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid

C16H15Cl2NO3 — CID 23650049

IUPAC5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid
SMILESO=C(O)c1cc(NCCCc2ccc(Cl)c(Cl)c2)ccc1O
InChIInChI=1S/C16H15Cl2NO3/c17-13-5-3-10(8-14(13)18)2-1-7-19-11-4-6-15(20)12(9-11)16(21)22/h3-6,8-9,19-20H,1-2,7H2,(H,21,22)
InChIKeyITJHWZWPRLEEKE-UHFFFAOYSA-N
MW340.21 g/mol
LogP4.44
Rot. Bonds6

About 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid

5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid (PubChem CID 23650049) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid.

Molecular Properties

Compound Name5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid
PubChem CID23650049
Molecular FormulaC16H15Cl2NO3
Molecular Weight340.21 g/mol
Exact Mass339.04
IUPAC Name5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid
SMILESO=C(O)c1cc(NCCCc2ccc(Cl)c(Cl)c2)ccc1O
InChIInChI=1S/C16H15Cl2NO3/c17-13-5-3-10(8-14(13)18)2-1-7-19-11-4-6-15(20)12(9-11)16(21)22/h3-6,8-9,19-20H,1-2,7H2,(H,21,22)
InChIKeyITJHWZWPRLEEKE-UHFFFAOYSA-N
XLogP4.44
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.21
LogP ≤ 54.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}

Analyze 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid?
The IUPAC name of 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid (CID 23650049) is 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid.
What is the SMILES notation for 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid?
The canonical SMILES for 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid is O=C(O)c1cc(NCCCc2ccc(Cl)c(Cl)c2)ccc1O.
What is the InChIKey of 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid?
The InChIKey is ITJHWZWPRLEEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO3/c17-13-5-3-10(8-14(13)18)2-1-7-19-11-4-6-15(20)12(9-11)16(21)22/h3-6,8-9,19-20H,1-2,7H2,(H,21,22).
What are the key properties of 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid?
5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid has a molecular weight of 340.21 g/mol, XLogP of 4.44, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,4-dichlorophenyl)propylamino]-2-hydroxybenzoic acid is sourced from PubChem (CID 23650049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).