C32H32N4O10 — CID 159923286
2-aminooxy-5-[3-(4-nitrophenyl)propyl]benzoic acid;2-hydroxy-5-[3-(4-nitrophenyl)propylamino]benzoic acid (PubChem CID 159923286) has the molecular formula C32H32N4O10 and a molecular weight of 632.63 g/mol. Its IUPAC name is 2-aminooxy-5-[3-(4-nitrophenyl)propyl]benzoic acid;2-hydroxy-5-[3-(4-nitrophenyl)propylamino]benzoic acid.
| Compound Name | 2-aminooxy-5-[3-(4-nitrophenyl)propyl]benzoic acid;2-hydroxy-5-[3-(4-nitrophenyl)propylamino]benzoic acid |
|---|---|
| PubChem CID | 159923286 |
| Molecular Formula | C32H32N4O10 |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | 2-aminooxy-5-[3-(4-nitrophenyl)propyl]benzoic acid;2-hydroxy-5-[3-(4-nitrophenyl)propylamino]benzoic acid |
| SMILES | NOc1ccc(CCCc2ccc([N+](=O)[O-])cc2)cc1C(=O)O.O=C(O)c1cc(NCCCc2ccc([N+](=O)[O-])cc2)ccc1O |
| InChI | InChI=1S/2C16H16N2O5/c19-15-8-5-12(10-14(15)16(20)21)17-9-1-2-11-3-6-13(7-4-11)18(22)23;17-23-15-9-6-12(10-14(15)16(19)20)3-1-2-11-4-7-13(8-5-11)18(21)22/h3-8,10,17,19H,1-2,9H2,(H,20,21);4-10H,1-3,17H2,(H,19,20) |
| InChIKey | NYROAYKUKQQTPL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 228.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|