C22H17Cl2NO4 — CID 141034567
2-[4-[2-(3,4-dichlorophenyl)ethyl]anilino]benzene-1,3-dicarboxylic acid (PubChem CID 141034567) has the molecular formula C22H17Cl2NO4 and a molecular weight of 430.29 g/mol. Its IUPAC name is 2-[4-[2-(3,4-dichlorophenyl)ethyl]anilino]benzene-1,3-dicarboxylic acid.
| Compound Name | 2-[4-[2-(3,4-dichlorophenyl)ethyl]anilino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141034567 |
| Molecular Formula | C22H17Cl2NO4 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 2-[4-[2-(3,4-dichlorophenyl)ethyl]anilino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cccc(C(=O)O)c1Nc1ccc(CCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H17Cl2NO4/c23-18-11-8-14(12-19(18)24)5-4-13-6-9-15(10-7-13)25-20-16(21(26)27)2-1-3-17(20)22(28)29/h1-3,6-12,25H,4-5H2,(H,26,27)(H,28,29) |
| InChIKey | WBILRPFBBBPFDV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |