C22H19Cl2NO3 — CID 22269685
2-[4-[2-(3,4-dichlorophenyl)ethyl]anilino]-5-methoxybenzoic acid (PubChem CID 22269685) has the molecular formula C22H19Cl2NO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is 2-[4-[2-(3,4-dichlorophenyl)ethyl]anilino]-5-methoxybenzoic acid.
| Compound Name | 2-[4-[2-(3,4-dichlorophenyl)ethyl]anilino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 22269685 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-[4-[2-(3,4-dichlorophenyl)ethyl]anilino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(Nc2ccc(CCc3ccc(Cl)c(Cl)c3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C22H19Cl2NO3/c1-28-17-9-11-21(18(13-17)22(26)27)25-16-7-4-14(5-8-16)2-3-15-6-10-19(23)20(24)12-15/h4-13,25H,2-3H2,1H3,(H,26,27) |
| InChIKey | MQKIXQGKIHJOGE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|