2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid

C24H23Cl2NO2 — CID 22269764

IUPAC2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid
SMILESO=C(O)c1ccccc1Nc1ccc(CCCCCc2ccc(Cl)c(Cl)c2)cc1
InChIInChI=1S/C24H23Cl2NO2/c25-21-15-12-18(16-22(21)26)7-3-1-2-6-17-10-13-19(14-11-17)27-23-9-5-4-8-20(23)24(28)29/h4-5,8-16,27H,1-3,6-7H2,(H,28,29)
InChIKeyOBWXNBGLQPAZQT-UHFFFAOYSA-N
MW428.36 g/mol
LogP7.39
Rot. Bonds9

About 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid

2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid (PubChem CID 22269764) has the molecular formula C24H23Cl2NO2 and a molecular weight of 428.36 g/mol. Its IUPAC name is 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid.

Molecular Properties

Compound Name2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid
PubChem CID22269764
Molecular FormulaC24H23Cl2NO2
Molecular Weight428.36 g/mol
Exact Mass427.11
IUPAC Name2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid
SMILESO=C(O)c1ccccc1Nc1ccc(CCCCCc2ccc(Cl)c(Cl)c2)cc1
InChIInChI=1S/C24H23Cl2NO2/c25-21-15-12-18(16-22(21)26)7-3-1-2-6-17-10-13-19(14-11-17)27-23-9-5-4-8-20(23)24(28)29/h4-5,8-16,27H,1-3,6-7H2,(H,28,29)
InChIKeyOBWXNBGLQPAZQT-UHFFFAOYSA-N
XLogP7.39
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms29
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500428.36
LogP ≤ 57.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid?
The IUPAC name of 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid (CID 22269764) is 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid.
What is the SMILES notation for 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid?
The canonical SMILES for 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid is O=C(O)c1ccccc1Nc1ccc(CCCCCc2ccc(Cl)c(Cl)c2)cc1.
What is the InChIKey of 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid?
The InChIKey is OBWXNBGLQPAZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23Cl2NO2/c25-21-15-12-18(16-22(21)26)7-3-1-2-6-17-10-13-19(14-11-17)27-23-9-5-4-8-20(23)24(28)29/h4-5,8-16,27H,1-3,6-7H2,(H,28,29).
What are the key properties of 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid?
2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid has a molecular weight of 428.36 g/mol, XLogP of 7.39, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid is sourced from PubChem (CID 22269764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).