C24H23Cl2NO2 — CID 22269764
2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid (PubChem CID 22269764) has the molecular formula C24H23Cl2NO2 and a molecular weight of 428.36 g/mol. Its IUPAC name is 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid.
| Compound Name | 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 22269764 |
| Molecular Formula | C24H23Cl2NO2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[4-[5-(3,4-dichlorophenyl)pentyl]anilino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1ccc(CCCCCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H23Cl2NO2/c25-21-15-12-18(16-22(21)26)7-3-1-2-6-17-10-13-19(14-11-17)27-23-9-5-4-8-20(23)24(28)29/h4-5,8-16,27H,1-3,6-7H2,(H,28,29) |
| InChIKey | OBWXNBGLQPAZQT-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|