About 2-anilinobenzoic acid;N-phenylaniline
2-anilinobenzoic acid;N-phenylaniline (PubChem CID 68732454) has the molecular formula C25H22N2O2
and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-anilinobenzoic acid;N-phenylaniline.
Molecular Properties
| Compound Name | 2-anilinobenzoic acid;N-phenylaniline |
| PubChem CID | 68732454 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-anilinobenzoic acid;N-phenylaniline |
| SMILES | O=C(O)c1ccccc1Nc1ccccc1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11NO2.C12H11N/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,14H,(H,15,16);1-10,13H |
| InChIKey | HFUKXDYVILGQBQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-anilinobenzoic acid;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinobenzoic acid;N-phenylaniline?
The IUPAC name of 2-anilinobenzoic acid;N-phenylaniline (CID 68732454) is 2-anilinobenzoic acid;N-phenylaniline.
What is the SMILES notation for 2-anilinobenzoic acid;N-phenylaniline?
The canonical SMILES for 2-anilinobenzoic acid;N-phenylaniline is O=C(O)c1ccccc1Nc1ccccc1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 2-anilinobenzoic acid;N-phenylaniline?
The InChIKey is HFUKXDYVILGQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2.C12H11N/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,14H,(H,15,16);1-10,13H.
What are the key properties of 2-anilinobenzoic acid;N-phenylaniline?
2-anilinobenzoic acid;N-phenylaniline has a molecular weight of 382.46 g/mol, XLogP of 6.56, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinobenzoic acid;N-phenylaniline is sourced from PubChem (CID 68732454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).