C25H24N2O6 — CID 53462415
2-[4-[2-carboxy-2-[(1-carboxy-2-phenylethyl)amino]ethyl]anilino]benzoic acid (PubChem CID 53462415) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-[4-[2-carboxy-2-[(1-carboxy-2-phenylethyl)amino]ethyl]anilino]benzoic acid.
| Compound Name | 2-[4-[2-carboxy-2-[(1-carboxy-2-phenylethyl)amino]ethyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 53462415 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-[4-[2-carboxy-2-[(1-carboxy-2-phenylethyl)amino]ethyl]anilino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1ccc(CC(NC(Cc2ccccc2)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C25H24N2O6/c28-23(29)19-8-4-5-9-20(19)26-18-12-10-17(11-13-18)15-22(25(32)33)27-21(24(30)31)14-16-6-2-1-3-7-16/h1-13,21-22,26-27H,14-15H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | PENOWLRGYBCUSJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |