C17H19NO2 — CID 86186147
2-(3-butylanilino)benzoic acid (PubChem CID 86186147) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(3-butylanilino)benzoic acid.
| Compound Name | 2-(3-butylanilino)benzoic acid |
|---|---|
| PubChem CID | 86186147 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(3-butylanilino)benzoic acid |
| SMILES | CCCCc1cccc(Nc2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C17H19NO2/c1-2-3-7-13-8-6-9-14(12-13)18-16-11-5-4-10-15(16)17(19)20/h4-6,8-12,18H,2-3,7H2,1H3,(H,19,20) |
| InChIKey | GPMYWBOOEKNCGR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |