C22H33N5O — CID 142468274
N'-[amino(2-hydroxyethyl)amino]-2-(3-heptylanilino)benzenecarboximidamide (PubChem CID 142468274) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is N'-[amino(2-hydroxyethyl)amino]-2-(3-heptylanilino)benzenecarboximidamide.
| Compound Name | N'-[amino(2-hydroxyethyl)amino]-2-(3-heptylanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 142468274 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | N'-[amino(2-hydroxyethyl)amino]-2-(3-heptylanilino)benzenecarboximidamide |
| SMILES | CCCCCCCc1cccc(Nc2ccccc2/C(N)=N/N(N)CCO)c1 |
| InChI | InChI=1S/C22H33N5O/c1-2-3-4-5-6-10-18-11-9-12-19(17-18)25-21-14-8-7-13-20(21)22(23)26-27(24)15-16-28/h7-9,11-14,17,25,28H,2-6,10,15-16,24H2,1H3,(H2,23,26) |
| InChIKey | PIBCCACGJVNHKB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|