About 4-(3-nonylanilino)phenol
4-(3-nonylanilino)phenol (PubChem CID 101298423) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is 4-(3-nonylanilino)phenol.
Molecular Properties
| Compound Name | 4-(3-nonylanilino)phenol |
| PubChem CID | 101298423 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 4-(3-nonylanilino)phenol |
| SMILES | CCCCCCCCCc1cccc(Nc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C21H29NO/c1-2-3-4-5-6-7-8-10-18-11-9-12-20(17-18)22-19-13-15-21(23)16-14-19/h9,11-17,22-23H,2-8,10H2,1H3 |
| InChIKey | APTCFBXMGHGPOX-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-nonylanilino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-nonylanilino)phenol?
The IUPAC name of 4-(3-nonylanilino)phenol (CID 101298423) is 4-(3-nonylanilino)phenol.
What is the SMILES notation for 4-(3-nonylanilino)phenol?
The canonical SMILES for 4-(3-nonylanilino)phenol is CCCCCCCCCc1cccc(Nc2ccc(O)cc2)c1.
What is the InChIKey of 4-(3-nonylanilino)phenol?
The InChIKey is APTCFBXMGHGPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO/c1-2-3-4-5-6-7-8-10-18-11-9-12-20(17-18)22-19-13-15-21(23)16-14-19/h9,11-17,22-23H,2-8,10H2,1H3.
What are the key properties of 4-(3-nonylanilino)phenol?
4-(3-nonylanilino)phenol has a molecular weight of 311.47 g/mol, XLogP of 6.43, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-nonylanilino)phenol is sourced from PubChem (CID 101298423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).