About 4-anilino-3-octylphenol
4-anilino-3-octylphenol (PubChem CID 101298415) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-anilino-3-octylphenol.
Molecular Properties
| Compound Name | 4-anilino-3-octylphenol |
| PubChem CID | 101298415 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 4-anilino-3-octylphenol |
| SMILES | CCCCCCCCc1cc(O)ccc1Nc1ccccc1 |
| InChI | InChI=1S/C20H27NO/c1-2-3-4-5-6-8-11-17-16-19(22)14-15-20(17)21-18-12-9-7-10-13-18/h7,9-10,12-16,21-22H,2-6,8,11H2,1H3 |
| InChIKey | OKXZYWOIBVYGAG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-anilino-3-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-3-octylphenol?
The IUPAC name of 4-anilino-3-octylphenol (CID 101298415) is 4-anilino-3-octylphenol.
What is the SMILES notation for 4-anilino-3-octylphenol?
The canonical SMILES for 4-anilino-3-octylphenol is CCCCCCCCc1cc(O)ccc1Nc1ccccc1.
What is the InChIKey of 4-anilino-3-octylphenol?
The InChIKey is OKXZYWOIBVYGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO/c1-2-3-4-5-6-8-11-17-16-19(22)14-15-20(17)21-18-12-9-7-10-13-18/h7,9-10,12-16,21-22H,2-6,8,11H2,1H3.
What are the key properties of 4-anilino-3-octylphenol?
4-anilino-3-octylphenol has a molecular weight of 297.44 g/mol, XLogP of 6.04, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-3-octylphenol is sourced from PubChem (CID 101298415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).