About 2-pentyl-N-phenylaniline
2-pentyl-N-phenylaniline (PubChem CID 20516677) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-pentyl-N-phenylaniline.
Molecular Properties
| Compound Name | 2-pentyl-N-phenylaniline |
| PubChem CID | 20516677 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2-pentyl-N-phenylaniline |
| SMILES | CCCCCc1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C17H21N/c1-2-3-5-10-15-11-8-9-14-17(15)18-16-12-6-4-7-13-16/h4,6-9,11-14,18H,2-3,5,10H2,1H3 |
| InChIKey | JRVPIJWRWAIXTF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-N-phenylaniline?
The IUPAC name of 2-pentyl-N-phenylaniline (CID 20516677) is 2-pentyl-N-phenylaniline.
What is the SMILES notation for 2-pentyl-N-phenylaniline?
The canonical SMILES for 2-pentyl-N-phenylaniline is CCCCCc1ccccc1Nc1ccccc1.
What is the InChIKey of 2-pentyl-N-phenylaniline?
The InChIKey is JRVPIJWRWAIXTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N/c1-2-3-5-10-15-11-8-9-14-17(15)18-16-12-6-4-7-13-16/h4,6-9,11-14,18H,2-3,5,10H2,1H3.
What are the key properties of 2-pentyl-N-phenylaniline?
2-pentyl-N-phenylaniline has a molecular weight of 239.36 g/mol, XLogP of 5.16, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-N-phenylaniline is sourced from PubChem (CID 20516677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).