C16H17Cl2N — CID 91412657
N-(3-butylphenyl)-3,5-dichloroaniline (PubChem CID 91412657) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is N-(3-butylphenyl)-3,5-dichloroaniline.
| Compound Name | N-(3-butylphenyl)-3,5-dichloroaniline |
|---|---|
| PubChem CID | 91412657 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-(3-butylphenyl)-3,5-dichloroaniline |
| SMILES | CCCCc1cccc(Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C16H17Cl2N/c1-2-3-5-12-6-4-7-15(8-12)19-16-10-13(17)9-14(18)11-16/h4,6-11,19H,2-3,5H2,1H3 |
| InChIKey | UKHPKQWWIHJLFE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |