About 1-chloro-3-octylbenzene
1-chloro-3-octylbenzene (PubChem CID 11458768) has the molecular formula C14H21Cl
and a molecular weight of 224.78 g/mol. Its IUPAC name is 1-chloro-3-octylbenzene.
Molecular Properties
| Compound Name | 1-chloro-3-octylbenzene |
| PubChem CID | 11458768 |
| Molecular Formula | C14H21Cl |
| Molecular Weight | 224.78 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-chloro-3-octylbenzene |
| SMILES | CCCCCCCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H21Cl/c1-2-3-4-5-6-7-9-13-10-8-11-14(15)12-13/h8,10-12H,2-7,9H2,1H3 |
| InChIKey | MQDNMYVGEYLQIW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.78 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-octylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-octylbenzene?
The IUPAC name of 1-chloro-3-octylbenzene (CID 11458768) is 1-chloro-3-octylbenzene.
What is the SMILES notation for 1-chloro-3-octylbenzene?
The canonical SMILES for 1-chloro-3-octylbenzene is CCCCCCCCc1cccc(Cl)c1.
What is the InChIKey of 1-chloro-3-octylbenzene?
The InChIKey is MQDNMYVGEYLQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Cl/c1-2-3-4-5-6-7-9-13-10-8-11-14(15)12-13/h8,10-12H,2-7,9H2,1H3.
What are the key properties of 1-chloro-3-octylbenzene?
1-chloro-3-octylbenzene has a molecular weight of 224.78 g/mol, XLogP of 5.24, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-octylbenzene is sourced from PubChem (CID 11458768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).