C13H20ClNO2S — CID 110601627
N-[4-(3-chlorophenyl)butyl]propane-1-sulfonamide (PubChem CID 110601627) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)butyl]propane-1-sulfonamide.
| Compound Name | N-[4-(3-chlorophenyl)butyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 110601627 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[4-(3-chlorophenyl)butyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H20ClNO2S/c1-2-10-18(16,17)15-9-4-3-6-12-7-5-8-13(14)11-12/h5,7-8,11,15H,2-4,6,9-10H2,1H3 |
| InChIKey | VNSZLYQYZRYAMN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|