C9H12ClNO3S — CID 79579372
N-[(3-chlorophenyl)methyl]-2-hydroxyethanesulfonamide (PubChem CID 79579372) has the molecular formula C9H12ClNO3S and a molecular weight of 249.72 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-hydroxyethanesulfonamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-hydroxyethanesulfonamide |
|---|---|
| PubChem CID | 79579372 |
| Molecular Formula | C9H12ClNO3S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-hydroxyethanesulfonamide |
| SMILES | O=S(=O)(CCO)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H12ClNO3S/c10-9-3-1-2-8(6-9)7-11-15(13,14)5-4-12/h1-3,6,11-12H,4-5,7H2 |
| InChIKey | LKNGYUIMAUYDEN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |