C9H12ClNO3S — CID 18439273
2-[(3-chlorophenyl)methylamino]ethanesulfonic acid (PubChem CID 18439273) has the molecular formula C9H12ClNO3S and a molecular weight of 249.72 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylamino]ethanesulfonic acid.
| Compound Name | 2-[(3-chlorophenyl)methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 18439273 |
| Molecular Formula | C9H12ClNO3S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-[(3-chlorophenyl)methylamino]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCNCc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H12ClNO3S/c10-9-3-1-2-8(6-9)7-11-4-5-15(12,13)14/h1-3,6,11H,4-5,7H2,(H,12,13,14) |
| InChIKey | YIFAENIIGITJQU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|