C9H14N2O3S — CID 21407783
2-[(4-aminophenyl)methylamino]ethanesulfonic acid (PubChem CID 21407783) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methylamino]ethanesulfonic acid.
| Compound Name | 2-[(4-aminophenyl)methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 21407783 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-[(4-aminophenyl)methylamino]ethanesulfonic acid |
| SMILES | Nc1ccc(CNCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H14N2O3S/c10-9-3-1-8(2-4-9)7-11-5-6-15(12,13)14/h1-4,11H,5-7,10H2,(H,12,13,14) |
| InChIKey | YYWCJBPXZQWLAH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|