C11H17NO3S — CID 11976877
3-[(4-methylphenyl)methylamino]propane-1-sulfonic acid (PubChem CID 11976877) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methylamino]propane-1-sulfonic acid.
| Compound Name | 3-[(4-methylphenyl)methylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 11976877 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-[(4-methylphenyl)methylamino]propane-1-sulfonic acid |
| SMILES | Cc1ccc(CNCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H17NO3S/c1-10-3-5-11(6-4-10)9-12-7-2-8-16(13,14)15/h3-6,12H,2,7-9H2,1H3,(H,13,14,15) |
| InChIKey | OGJHDNWNPJKABN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|