C10H14FNO3S — CID 11673206
3-[(4-fluorophenyl)methylamino]propane-1-sulfonic acid (PubChem CID 11673206) has the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylamino]propane-1-sulfonic acid.
| Compound Name | 3-[(4-fluorophenyl)methylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 11673206 |
| Molecular Formula | C10H14FNO3S |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-[(4-fluorophenyl)methylamino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C10H14FNO3S/c11-10-4-2-9(3-5-10)8-12-6-1-7-16(13,14)15/h2-5,12H,1,6-8H2,(H,13,14,15) |
| InChIKey | UMJVFUYQVVGDOA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|