C18H20FNO4 — CID 17078916
N-[(4-fluorophenyl)methyl]-3-phenylpropan-1-amine;oxalic acid (PubChem CID 17078916) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-phenylpropan-1-amine;oxalic acid.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-phenylpropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 17078916 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-phenylpropan-1-amine;oxalic acid |
| SMILES | Fc1ccc(CNCCCc2ccccc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H18FN.C2H2O4/c17-16-10-8-15(9-11-16)13-18-12-4-7-14-5-2-1-3-6-14;3-1(4)2(5)6/h1-3,5-6,8-11,18H,4,7,12-13H2;(H,3,4)(H,5,6) |
| InChIKey | MQOHJGBHXJPSKH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|