C17H20FN — CID 60705049
N-[(4-fluoro-3-methylphenyl)methyl]-3-phenylpropan-1-amine (PubChem CID 60705049) has the molecular formula C17H20FN and a molecular weight of 257.35 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-3-phenylpropan-1-amine.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 60705049 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-3-phenylpropan-1-amine |
| SMILES | Cc1cc(CNCCCc2ccccc2)ccc1F |
| InChI | InChI=1S/C17H20FN/c1-14-12-16(9-10-17(14)18)13-19-11-5-8-15-6-3-2-4-7-15/h2-4,6-7,9-10,12,19H,5,8,11,13H2,1H3 |
| InChIKey | KKYBZHMLLBJUNJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|