C11H16FNS — CID 63378460
N-[(4-fluoro-3-methylphenyl)methyl]-2-methylsulfanylethanamine (PubChem CID 63378460) has the molecular formula C11H16FNS and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 63378460 |
| Molecular Formula | C11H16FNS |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-2-methylsulfanylethanamine |
| SMILES | CSCCNCc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C11H16FNS/c1-9-7-10(3-4-11(9)12)8-13-5-6-14-2/h3-4,7,13H,5-6,8H2,1-2H3 |
| InChIKey | MKJADATYSQTBNH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|