C10H13Br2NS — CID 115692957
N-[(3,4-dibromophenyl)methyl]-2-methylsulfanylethanamine (PubChem CID 115692957) has the molecular formula C10H13Br2NS and a molecular weight of 339.10 g/mol. Its IUPAC name is N-[(3,4-dibromophenyl)methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[(3,4-dibromophenyl)methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 115692957 |
| Molecular Formula | C10H13Br2NS |
| Molecular Weight | 339.10 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | N-[(3,4-dibromophenyl)methyl]-2-methylsulfanylethanamine |
| SMILES | CSCCNCc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C10H13Br2NS/c1-14-5-4-13-7-8-2-3-9(11)10(12)6-8/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | ATOFJXWTKVMJTH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.10 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|