C13H20BrNS — CID 115668237
N-[(4-bromo-3-methylphenyl)methyl]-4-methylsulfanylbutan-1-amine (PubChem CID 115668237) has the molecular formula C13H20BrNS and a molecular weight of 302.28 g/mol. Its IUPAC name is N-[(4-bromo-3-methylphenyl)methyl]-4-methylsulfanylbutan-1-amine.
| Compound Name | N-[(4-bromo-3-methylphenyl)methyl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 115668237 |
| Molecular Formula | C13H20BrNS |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-[(4-bromo-3-methylphenyl)methyl]-4-methylsulfanylbutan-1-amine |
| SMILES | CSCCCCNCc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C13H20BrNS/c1-11-9-12(5-6-13(11)14)10-15-7-3-4-8-16-2/h5-6,9,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | RBJJGCOCNZJFBY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|