C13H19Br2NO — CID 113352570
6-[(3,4-dibromophenyl)methylamino]hexan-1-ol (PubChem CID 113352570) has the molecular formula C13H19Br2NO and a molecular weight of 365.11 g/mol. Its IUPAC name is 6-[(3,4-dibromophenyl)methylamino]hexan-1-ol.
| Compound Name | 6-[(3,4-dibromophenyl)methylamino]hexan-1-ol |
|---|---|
| PubChem CID | 113352570 |
| Molecular Formula | C13H19Br2NO |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 6-[(3,4-dibromophenyl)methylamino]hexan-1-ol |
| SMILES | OCCCCCCNCc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C13H19Br2NO/c14-12-6-5-11(9-13(12)15)10-16-7-3-1-2-4-8-17/h5-6,9,16-17H,1-4,7-8,10H2 |
| InChIKey | JSDCJMYJUFQUGI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|