C15H15Br2NO — CID 107229828
[4-[[(3,4-dibromophenyl)methylamino]methyl]phenyl]methanol (PubChem CID 107229828) has the molecular formula C15H15Br2NO and a molecular weight of 385.10 g/mol. Its IUPAC name is [4-[[(3,4-dibromophenyl)methylamino]methyl]phenyl]methanol.
| Compound Name | [4-[[(3,4-dibromophenyl)methylamino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 107229828 |
| Molecular Formula | C15H15Br2NO |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | [4-[[(3,4-dibromophenyl)methylamino]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CNCc2ccc(Br)c(Br)c2)cc1 |
| InChI | InChI=1S/C15H15Br2NO/c16-14-6-5-13(7-15(14)17)9-18-8-11-1-3-12(10-19)4-2-11/h1-7,18-19H,8-10H2 |
| InChIKey | NVSGMSCKYBQPJR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |