C10H13Br2NO2 — CID 75525106
2-[(3,4-dibromophenyl)methylamino]propane-1,3-diol (PubChem CID 75525106) has the molecular formula C10H13Br2NO2 and a molecular weight of 339.03 g/mol. Its IUPAC name is 2-[(3,4-dibromophenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(3,4-dibromophenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 75525106 |
| Molecular Formula | C10H13Br2NO2 |
| Molecular Weight | 339.03 g/mol |
| Exact Mass | 336.93 |
| IUPAC Name | 2-[(3,4-dibromophenyl)methylamino]propane-1,3-diol |
| SMILES | OCC(CO)NCc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C10H13Br2NO2/c11-9-2-1-7(3-10(9)12)4-13-8(5-14)6-15/h1-3,8,13-15H,4-6H2 |
| InChIKey | DNLAFWDSKDGOFW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.03 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |