C17H20BrNO — CID 104922947
(2R)-2-[(3-bromo-4-methylphenyl)methylamino]-3-phenylpropan-1-ol (PubChem CID 104922947) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is (2R)-2-[(3-bromo-4-methylphenyl)methylamino]-3-phenylpropan-1-ol.
| Compound Name | (2R)-2-[(3-bromo-4-methylphenyl)methylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 104922947 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (2R)-2-[(3-bromo-4-methylphenyl)methylamino]-3-phenylpropan-1-ol |
| SMILES | Cc1ccc(CN[C@@H](CO)Cc2ccccc2)cc1Br |
| InChI | InChI=1S/C17H20BrNO/c1-13-7-8-15(10-17(13)18)11-19-16(12-20)9-14-5-3-2-4-6-14/h2-8,10,16,19-20H,9,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | PRUXXLKVGOEUBW-MRXNPFEDSA-N |
| XLogP | 3.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |