C16H17BrFNO — CID 102610133
(2S)-2-[(4-bromo-3-fluorophenyl)methylamino]-3-phenylpropan-1-ol (PubChem CID 102610133) has the molecular formula C16H17BrFNO and a molecular weight of 338.22 g/mol. Its IUPAC name is (2S)-2-[(4-bromo-3-fluorophenyl)methylamino]-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-[(4-bromo-3-fluorophenyl)methylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 102610133 |
| Molecular Formula | C16H17BrFNO |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (2S)-2-[(4-bromo-3-fluorophenyl)methylamino]-3-phenylpropan-1-ol |
| SMILES | OC[C@H](Cc1ccccc1)NCc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C16H17BrFNO/c17-15-7-6-13(9-16(15)18)10-19-14(11-20)8-12-4-2-1-3-5-12/h1-7,9,14,19-20H,8,10-11H2/t14-/m0/s1 |
| InChIKey | RKFNVWRXPLRKPR-AWEZNQCLSA-N |
| XLogP | 3.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |