C16H18FNO2 — CID 104922782
3-fluoro-5-[[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]methyl]phenol (PubChem CID 104922782) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-fluoro-5-[[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]methyl]phenol.
| Compound Name | 3-fluoro-5-[[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 104922782 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-fluoro-5-[[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]methyl]phenol |
| SMILES | OC[C@@H](Cc1ccccc1)NCc1cc(O)cc(F)c1 |
| InChI | InChI=1S/C16H18FNO2/c17-14-6-13(8-16(20)9-14)10-18-15(11-19)7-12-4-2-1-3-5-12/h1-6,8-9,15,18-20H,7,10-11H2/t15-/m1/s1 |
| InChIKey | DHILAETUJZHMCL-OAHLLOKOSA-N |
| XLogP | 2.22 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |