C9H11Br2NO — CID 75525100
2-[(3,4-dibromophenyl)methylamino]ethanol (PubChem CID 75525100) has the molecular formula C9H11Br2NO and a molecular weight of 309.00 g/mol. Its IUPAC name is 2-[(3,4-dibromophenyl)methylamino]ethanol.
| Compound Name | 2-[(3,4-dibromophenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 75525100 |
| Molecular Formula | C9H11Br2NO |
| Molecular Weight | 309.00 g/mol |
| Exact Mass | 306.92 |
| IUPAC Name | 2-[(3,4-dibromophenyl)methylamino]ethanol |
| SMILES | OCCNCc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C9H11Br2NO/c10-8-2-1-7(5-9(8)11)6-12-3-4-13/h1-2,5,12-13H,3-4,6H2 |
| InChIKey | ZGXUDGWXDBFKQL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.00 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|