C10H11BrF3NO2 — CID 107342223
2-[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]ethanol (PubChem CID 107342223) has the molecular formula C10H11BrF3NO2 and a molecular weight of 314.10 g/mol. Its IUPAC name is 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]ethanol.
| Compound Name | 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 107342223 |
| Molecular Formula | C10H11BrF3NO2 |
| Molecular Weight | 314.10 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]ethanol |
| SMILES | OCCNCc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H11BrF3NO2/c11-8-5-7(6-15-3-4-16)1-2-9(8)17-10(12,13)14/h1-2,5,15-16H,3-4,6H2 |
| InChIKey | FSMQCLOLGPPDHX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.10 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|