C13H10Br2F3NOS — CID 107342370
N-[(4-bromothiophen-2-yl)methyl]-1-[3-bromo-4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 107342370) has the molecular formula C13H10Br2F3NOS and a molecular weight of 445.10 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-[3-bromo-4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-[3-bromo-4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 107342370 |
| Molecular Formula | C13H10Br2F3NOS |
| Molecular Weight | 445.10 g/mol |
| Exact Mass | 442.88 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-[3-bromo-4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | FC(F)(F)Oc1ccc(CNCc2cc(Br)cs2)cc1Br |
| InChI | InChI=1S/C13H10Br2F3NOS/c14-9-4-10(21-7-9)6-19-5-8-1-2-12(11(15)3-8)20-13(16,17)18/h1-4,7,19H,5-6H2 |
| InChIKey | CTTKTZBJMPKDPG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.10 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |