C13H13BrF3N3O — CID 107342350
1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-[(1-methylimidazol-2-yl)methyl]methanamine (PubChem CID 107342350) has the molecular formula C13H13BrF3N3O and a molecular weight of 364.17 g/mol. Its IUPAC name is 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-[(1-methylimidazol-2-yl)methyl]methanamine.
| Compound Name | 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-[(1-methylimidazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 107342350 |
| Molecular Formula | C13H13BrF3N3O |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-[(1-methylimidazol-2-yl)methyl]methanamine |
| SMILES | Cn1ccnc1CNCc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H13BrF3N3O/c1-20-5-4-19-12(20)8-18-7-9-2-3-11(10(14)6-9)21-13(15,16)17/h2-6,18H,7-8H2,1H3 |
| InChIKey | JOXCZYVALIAUAZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |