C10H12BrF3N2O — CID 107342453
2-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1,1-dimethylhydrazine (PubChem CID 107342453) has the molecular formula C10H12BrF3N2O and a molecular weight of 313.12 g/mol. Its IUPAC name is 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 107342453 |
| Molecular Formula | C10H12BrF3N2O |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NCc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H12BrF3N2O/c1-16(2)15-6-7-3-4-9(8(11)5-7)17-10(12,13)14/h3-5,15H,6H2,1-2H3 |
| InChIKey | MWFYQWWOGXAJAQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|