C14H17BrF3NO — CID 107342298
N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-methylcyclopentan-1-amine (PubChem CID 107342298) has the molecular formula C14H17BrF3NO and a molecular weight of 352.19 g/mol. Its IUPAC name is N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-methylcyclopentan-1-amine.
| Compound Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 107342298 |
| Molecular Formula | C14H17BrF3NO |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-methylcyclopentan-1-amine |
| SMILES | CC1(NCc2ccc(OC(F)(F)F)c(Br)c2)CCCC1 |
| InChI | InChI=1S/C14H17BrF3NO/c1-13(6-2-3-7-13)19-9-10-4-5-12(11(15)8-10)20-14(16,17)18/h4-5,8,19H,2-3,6-7,9H2,1H3 |
| InChIKey | OUEQQRPRCROWFX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |