C17H15BrF3NO — CID 123294871
N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-phenylcyclopropan-1-amine (PubChem CID 123294871) has the molecular formula C17H15BrF3NO and a molecular weight of 386.21 g/mol. Its IUPAC name is N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-phenylcyclopropan-1-amine.
| Compound Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 123294871 |
| Molecular Formula | C17H15BrF3NO |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-phenylcyclopropan-1-amine |
| SMILES | FC(F)(F)Oc1ccc(CNC2(c3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C17H15BrF3NO/c18-14-10-12(6-7-15(14)23-17(19,20)21)11-22-16(8-9-16)13-4-2-1-3-5-13/h1-7,10,22H,8-9,11H2 |
| InChIKey | DWOGRQQQFYTUAU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |