C12H15BrF3NOS — CID 107342475
N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-2-methylsulfanylpropan-1-amine (PubChem CID 107342475) has the molecular formula C12H15BrF3NOS and a molecular weight of 358.22 g/mol. Its IUPAC name is N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-2-methylsulfanylpropan-1-amine.
| Compound Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-2-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 107342475 |
| Molecular Formula | C12H15BrF3NOS |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-2-methylsulfanylpropan-1-amine |
| SMILES | CSC(C)CNCc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H15BrF3NOS/c1-8(19-2)6-17-7-9-3-4-11(10(13)5-9)18-12(14,15)16/h3-5,8,17H,6-7H2,1-2H3 |
| InChIKey | DXXSGKSWFWQTAA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |