C13H17BrF3NOS — CID 107342509
N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-methylsulfanylbutan-2-amine (PubChem CID 107342509) has the molecular formula C13H17BrF3NOS and a molecular weight of 372.25 g/mol. Its IUPAC name is N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-methylsulfanylbutan-2-amine.
| Compound Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 107342509 |
| Molecular Formula | C13H17BrF3NOS |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | N-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]-1-methylsulfanylbutan-2-amine |
| SMILES | CCC(CSC)NCc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H17BrF3NOS/c1-3-10(8-20-2)18-7-9-4-5-12(11(14)6-9)19-13(15,16)17/h4-6,10,18H,3,7-8H2,1-2H3 |
| InChIKey | PXCPKJCCZSJLRZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |