C13H20FNOS — CID 115899852
N-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylsulfanylbutan-2-amine (PubChem CID 115899852) has the molecular formula C13H20FNOS and a molecular weight of 257.37 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylsulfanylbutan-2-amine.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 115899852 |
| Molecular Formula | C13H20FNOS |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-1-methylsulfanylbutan-2-amine |
| SMILES | CCC(CSC)NCc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H20FNOS/c1-4-11(9-17-3)15-8-10-5-6-13(16-2)12(14)7-10/h5-7,11,15H,4,8-9H2,1-3H3 |
| InChIKey | OPOZZCJLMOFMSQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |