C16H26FNOS — CID 65131905
1-(3-fluoro-4-methoxyphenyl)-3-propan-2-ylsulfanyl-N-propylpropan-2-amine (PubChem CID 65131905) has the molecular formula C16H26FNOS and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-3-propan-2-ylsulfanyl-N-propylpropan-2-amine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-3-propan-2-ylsulfanyl-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 65131905 |
| Molecular Formula | C16H26FNOS |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-3-propan-2-ylsulfanyl-N-propylpropan-2-amine |
| SMILES | CCCNC(CSC(C)C)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C16H26FNOS/c1-5-8-18-14(11-20-12(2)3)9-13-6-7-16(19-4)15(17)10-13/h6-7,10,12,14,18H,5,8-9,11H2,1-4H3 |
| InChIKey | HMDHSLITBYVFCM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |