C14H23FN2OS — CID 105227140
[1-butan-2-ylsulfanyl-3-(3-fluoro-4-methoxyphenyl)propan-2-yl]hydrazine (PubChem CID 105227140) has the molecular formula C14H23FN2OS and a molecular weight of 286.42 g/mol. Its IUPAC name is [1-butan-2-ylsulfanyl-3-(3-fluoro-4-methoxyphenyl)propan-2-yl]hydrazine.
| Compound Name | [1-butan-2-ylsulfanyl-3-(3-fluoro-4-methoxyphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105227140 |
| Molecular Formula | C14H23FN2OS |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [1-butan-2-ylsulfanyl-3-(3-fluoro-4-methoxyphenyl)propan-2-yl]hydrazine |
| SMILES | CCC(C)SCC(Cc1ccc(OC)c(F)c1)NN |
| InChI | InChI=1S/C14H23FN2OS/c1-4-10(2)19-9-12(17-16)7-11-5-6-14(18-3)13(15)8-11/h5-6,8,10,12,17H,4,7,9,16H2,1-3H3 |
| InChIKey | XIJYWLAIMCBIND-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|