C13H21ClN2S — CID 105227316
[1-butan-2-ylsulfanyl-3-(3-chlorophenyl)propan-2-yl]hydrazine (PubChem CID 105227316) has the molecular formula C13H21ClN2S and a molecular weight of 272.84 g/mol. Its IUPAC name is [1-butan-2-ylsulfanyl-3-(3-chlorophenyl)propan-2-yl]hydrazine.
| Compound Name | [1-butan-2-ylsulfanyl-3-(3-chlorophenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105227316 |
| Molecular Formula | C13H21ClN2S |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | [1-butan-2-ylsulfanyl-3-(3-chlorophenyl)propan-2-yl]hydrazine |
| SMILES | CCC(C)SCC(Cc1cccc(Cl)c1)NN |
| InChI | InChI=1S/C13H21ClN2S/c1-3-10(2)17-9-13(16-15)8-11-5-4-6-12(14)7-11/h4-7,10,13,16H,3,8-9,15H2,1-2H3 |
| InChIKey | GCHLZOIEAINAKZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|