C16H19ClN2S — CID 105237861
[1-(3-chlorophenyl)sulfanyl-3-(3-methylphenyl)propan-2-yl]hydrazine (PubChem CID 105237861) has the molecular formula C16H19ClN2S and a molecular weight of 306.86 g/mol. Its IUPAC name is [1-(3-chlorophenyl)sulfanyl-3-(3-methylphenyl)propan-2-yl]hydrazine.
| Compound Name | [1-(3-chlorophenyl)sulfanyl-3-(3-methylphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105237861 |
| Molecular Formula | C16H19ClN2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [1-(3-chlorophenyl)sulfanyl-3-(3-methylphenyl)propan-2-yl]hydrazine |
| SMILES | Cc1cccc(CC(CSc2cccc(Cl)c2)NN)c1 |
| InChI | InChI=1S/C16H19ClN2S/c1-12-4-2-5-13(8-12)9-15(19-18)11-20-16-7-3-6-14(17)10-16/h2-8,10,15,19H,9,11,18H2,1H3 |
| InChIKey | HYZUXTTXJUJVDD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|