C16H18ClFN2S — CID 105237086
[1-(2-chloro-3-fluorophenyl)-3-(3-methylphenyl)sulfanylpropan-2-yl]hydrazine (PubChem CID 105237086) has the molecular formula C16H18ClFN2S and a molecular weight of 324.85 g/mol. Its IUPAC name is [1-(2-chloro-3-fluorophenyl)-3-(3-methylphenyl)sulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-3-fluorophenyl)-3-(3-methylphenyl)sulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105237086 |
| Molecular Formula | C16H18ClFN2S |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [1-(2-chloro-3-fluorophenyl)-3-(3-methylphenyl)sulfanylpropan-2-yl]hydrazine |
| SMILES | Cc1cccc(SCC(Cc2cccc(F)c2Cl)NN)c1 |
| InChI | InChI=1S/C16H18ClFN2S/c1-11-4-2-6-14(8-11)21-10-13(20-19)9-12-5-3-7-15(18)16(12)17/h2-8,13,20H,9-10,19H2,1H3 |
| InChIKey | BLDOVCQPJCGDJQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|