C16H17Cl2NS — CID 66146432
1-(4-chlorophenyl)-3-(3-chlorophenyl)sulfanyl-N-methylpropan-2-amine (PubChem CID 66146432) has the molecular formula C16H17Cl2NS and a molecular weight of 326.29 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3-chlorophenyl)sulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-(4-chlorophenyl)-3-(3-chlorophenyl)sulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 66146432 |
| Molecular Formula | C16H17Cl2NS |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3-chlorophenyl)sulfanyl-N-methylpropan-2-amine |
| SMILES | CNC(CSc1cccc(Cl)c1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2NS/c1-19-15(9-12-5-7-13(17)8-6-12)11-20-16-4-2-3-14(18)10-16/h2-8,10,15,19H,9,11H2,1H3 |
| InChIKey | ZDCQJIIQTVSZKH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |