C16H16Cl2FNS — CID 66147469
1-(2-chloro-6-fluorophenyl)-3-(3-chlorophenyl)sulfanyl-N-methylpropan-2-amine (PubChem CID 66147469) has the molecular formula C16H16Cl2FNS and a molecular weight of 344.28 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-3-(3-chlorophenyl)sulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-3-(3-chlorophenyl)sulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 66147469 |
| Molecular Formula | C16H16Cl2FNS |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-3-(3-chlorophenyl)sulfanyl-N-methylpropan-2-amine |
| SMILES | CNC(CSc1cccc(Cl)c1)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H16Cl2FNS/c1-20-12(9-14-15(18)6-3-7-16(14)19)10-21-13-5-2-4-11(17)8-13/h2-8,12,20H,9-10H2,1H3 |
| InChIKey | UJOZUXRTKSNMKK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |