C13H21ClN2O — CID 105283444
[1-(3-chlorophenyl)-5-ethoxypentan-2-yl]hydrazine (PubChem CID 105283444) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-5-ethoxypentan-2-yl]hydrazine.
| Compound Name | [1-(3-chlorophenyl)-5-ethoxypentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105283444 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [1-(3-chlorophenyl)-5-ethoxypentan-2-yl]hydrazine |
| SMILES | CCOCCCC(Cc1cccc(Cl)c1)NN |
| InChI | InChI=1S/C13H21ClN2O/c1-2-17-8-4-7-13(16-15)10-11-5-3-6-12(14)9-11/h3,5-6,9,13,16H,2,4,7-8,10,15H2,1H3 |
| InChIKey | VXZMIRYDNOURLV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|